C29H25N5OS — CID 11283259
3-[[4-[5-(5-amino-1,3,4-thiadiazol-2-yl)-3-phenyl-2-pyridinyl]phenyl]methylamino]-1-phenylpropan-1-one (PubChem CID 11283259) has the molecular formula C29H25N5OS and a molecular weight of 491.62 g/mol. Its IUPAC name is 3-[[4-[5-(5-amino-1,3,4-thiadiazol-2-yl)-3-phenyl-2-pyridinyl]phenyl]methylamino]-1-phenylpropan-1-one.
| Compound Name | 3-[[4-[5-(5-amino-1,3,4-thiadiazol-2-yl)-3-phenyl-2-pyridinyl]phenyl]methylamino]-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 11283259 |
| Molecular Formula | C29H25N5OS |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 3-[[4-[5-(5-amino-1,3,4-thiadiazol-2-yl)-3-phenyl-2-pyridinyl]phenyl]methylamino]-1-phenylpropan-1-one |
| SMILES | Nc1nnc(-c2cnc(-c3ccc(CNCCC(=O)c4ccccc4)cc3)c(-c3ccccc3)c2)s1 |
| InChI | InChI=1S/C29H25N5OS/c30-29-34-33-28(36-29)24-17-25(21-7-3-1-4-8-21)27(32-19-24)23-13-11-20(12-14-23)18-31-16-15-26(35)22-9-5-2-6-10-22/h1-14,17,19,31H,15-16,18H2,(H2,30,34) |
| InChIKey | QFYQBLZUUJQWLZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|