C24H19F3N2O2S — CID 59773052
3-[[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzothiazol-5-yl]methylamino]propanoic acid (PubChem CID 59773052) has the molecular formula C24H19F3N2O2S and a molecular weight of 456.49 g/mol. Its IUPAC name is 3-[[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzothiazol-5-yl]methylamino]propanoic acid.
| Compound Name | 3-[[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzothiazol-5-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 59773052 |
| Molecular Formula | C24H19F3N2O2S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3-[[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzothiazol-5-yl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc2sc(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C24H19F3N2O2S/c25-24(26,27)19-13-17(7-8-18(19)16-4-2-1-3-5-16)23-29-20-12-15(6-9-21(20)32-23)14-28-11-10-22(30)31/h1-9,12-13,28H,10-11,14H2,(H,30,31) |
| InChIKey | PFLHNXVUTWDFDF-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|