C25H21F3N2O3 — CID 70694325
2-[3-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]propylamino]acetic acid (PubChem CID 70694325) has the molecular formula C25H21F3N2O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-[3-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]propylamino]acetic acid.
| Compound Name | 2-[3-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]propylamino]acetic acid |
|---|---|
| PubChem CID | 70694325 |
| Molecular Formula | C25H21F3N2O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-[3-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-5-yl]propylamino]acetic acid |
| SMILES | O=C(O)CNCCCc1ccc2oc(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C25H21F3N2O3/c26-25(27,28)20-14-18(9-10-19(20)17-6-2-1-3-7-17)24-30-21-13-16(8-11-22(21)33-24)5-4-12-29-15-23(31)32/h1-3,6-11,13-14,29H,4-5,12,15H2,(H,31,32) |
| InChIKey | JPUUPOWQVFXSDS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|