C25H22F3N3O2 — CID 70688067
6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]hexanoic acid (PubChem CID 70688067) has the molecular formula C25H22F3N3O2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]hexanoic acid.
| Compound Name | 6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 70688067 |
| Molecular Formula | C25H22F3N3O2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 6-[2-[4-phenyl-3-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1ccn2nc(-c3ccc(-c4ccccc4)c(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C25H22F3N3O2/c26-25(27,28)21-16-19(11-12-20(21)18-8-4-2-5-9-18)24-29-22-15-17(13-14-31(22)30-24)7-3-1-6-10-23(32)33/h2,4-5,8-9,11-16H,1,3,6-7,10H2,(H,32,33) |
| InChIKey | BKTPFRJQIFQRSG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|