C26H23F3N2O3 — CID 11488190
3-[[2-[4-(2-phenylethyl)-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid (PubChem CID 11488190) has the molecular formula C26H23F3N2O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is 3-[[2-[4-(2-phenylethyl)-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid.
| Compound Name | 3-[[2-[4-(2-phenylethyl)-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 11488190 |
| Molecular Formula | C26H23F3N2O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[[2-[4-(2-phenylethyl)-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-6-yl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc2nc(-c3ccc(CCc4ccccc4)c(C(F)(F)F)c3)oc2c1 |
| InChI | InChI=1S/C26H23F3N2O3/c27-26(28,29)21-15-20(10-9-19(21)8-6-17-4-2-1-3-5-17)25-31-22-11-7-18(14-23(22)34-25)16-30-13-12-24(32)33/h1-5,7,9-11,14-15,30H,6,8,12-13,16H2,(H,32,33) |
| InChIKey | PKBITSHZCDITFP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|