C22H18N2O3 — CID 11581243
3-[6-(2-phenylethylamino)-1,3-benzoxazol-2-yl]benzoic acid (PubChem CID 11581243) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[6-(2-phenylethylamino)-1,3-benzoxazol-2-yl]benzoic acid.
| Compound Name | 3-[6-(2-phenylethylamino)-1,3-benzoxazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 11581243 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 3-[6-(2-phenylethylamino)-1,3-benzoxazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nc3ccc(NCCc4ccccc4)cc3o2)c1 |
| InChI | InChI=1S/C22H18N2O3/c25-22(26)17-8-4-7-16(13-17)21-24-19-10-9-18(14-20(19)27-21)23-12-11-15-5-2-1-3-6-15/h1-10,13-14,23H,11-12H2,(H,25,26) |
| InChIKey | QGLJQAZRXRSFAT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |