C20H22N2O4 — CID 11508652
3-[6-(6-hydroxyhexylamino)-1,3-benzoxazol-2-yl]benzoic acid (PubChem CID 11508652) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[6-(6-hydroxyhexylamino)-1,3-benzoxazol-2-yl]benzoic acid.
| Compound Name | 3-[6-(6-hydroxyhexylamino)-1,3-benzoxazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 11508652 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-[6-(6-hydroxyhexylamino)-1,3-benzoxazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nc3ccc(NCCCCCCO)cc3o2)c1 |
| InChI | InChI=1S/C20H22N2O4/c23-11-4-2-1-3-10-21-16-8-9-17-18(13-16)26-19(22-17)14-6-5-7-15(12-14)20(24)25/h5-9,12-13,21,23H,1-4,10-11H2,(H,24,25) |
| InChIKey | QFFVPXWTPSCIJJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|