C15H13ClN2O2 — CID 81433846
2-[4-(6-chloro-1,3-benzoxazol-2-yl)anilino]ethanol (PubChem CID 81433846) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-[4-(6-chloro-1,3-benzoxazol-2-yl)anilino]ethanol.
| Compound Name | 2-[4-(6-chloro-1,3-benzoxazol-2-yl)anilino]ethanol |
|---|---|
| PubChem CID | 81433846 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-[4-(6-chloro-1,3-benzoxazol-2-yl)anilino]ethanol |
| SMILES | OCCNc1ccc(-c2nc3ccc(Cl)cc3o2)cc1 |
| InChI | InChI=1S/C15H13ClN2O2/c16-11-3-6-13-14(9-11)20-15(18-13)10-1-4-12(5-2-10)17-7-8-19/h1-6,9,17,19H,7-8H2 |
| InChIKey | TWJVCPBKGOBOGQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |