C15H10ClN3O — CID 139379765
6-chloro-2-(1-methylindazol-6-yl)-1,3-benzoxazole (PubChem CID 139379765) has the molecular formula C15H10ClN3O and a molecular weight of 283.72 g/mol. Its IUPAC name is 6-chloro-2-(1-methylindazol-6-yl)-1,3-benzoxazole.
| Compound Name | 6-chloro-2-(1-methylindazol-6-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 139379765 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-chloro-2-(1-methylindazol-6-yl)-1,3-benzoxazole |
| SMILES | Cn1ncc2ccc(-c3nc4ccc(Cl)cc4o3)cc21 |
| InChI | InChI=1S/C15H10ClN3O/c1-19-13-6-9(2-3-10(13)8-17-19)15-18-12-5-4-11(16)7-14(12)20-15/h2-8H,1H3 |
| InChIKey | JHEKSNSROAUMMZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |