C16H14ClNO2 — CID 171512130
5-(6-chloro-1,3-benzoxazol-2-yl)-2-propan-2-ylphenol (PubChem CID 171512130) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 5-(6-chloro-1,3-benzoxazol-2-yl)-2-propan-2-ylphenol.
| Compound Name | 5-(6-chloro-1,3-benzoxazol-2-yl)-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 171512130 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-(6-chloro-1,3-benzoxazol-2-yl)-2-propan-2-ylphenol |
| SMILES | CC(C)c1ccc(-c2nc3ccc(Cl)cc3o2)cc1O |
| InChI | InChI=1S/C16H14ClNO2/c1-9(2)12-5-3-10(7-14(12)19)16-18-13-6-4-11(17)8-15(13)20-16/h3-9,19H,1-2H3 |
| InChIKey | NBFFZZWLARJNGL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |