C18H19Cl2NO — CID 166119017
2-(3,5-dichlorophenyl)-6-propan-2-yl-1,3-benzoxazole;ethane (PubChem CID 166119017) has the molecular formula C18H19Cl2NO and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-6-propan-2-yl-1,3-benzoxazole;ethane.
| Compound Name | 2-(3,5-dichlorophenyl)-6-propan-2-yl-1,3-benzoxazole;ethane |
|---|---|
| PubChem CID | 166119017 |
| Molecular Formula | C18H19Cl2NO |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-6-propan-2-yl-1,3-benzoxazole;ethane |
| SMILES | CC.CC(C)c1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C16H13Cl2NO.C2H6/c1-9(2)10-3-4-14-15(7-10)20-16(19-14)11-5-12(17)8-13(18)6-11;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | OCMFWJXPTMYEFB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |