About 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole
6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole (PubChem CID 163207320) has the molecular formula C17H15Cl2NO
and a molecular weight of 320.22 g/mol. Its IUPAC name is 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole |
| PubChem CID | 163207320 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole |
| SMILES | CCCCc1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C17H15Cl2NO/c1-2-3-4-11-5-6-15-16(7-11)21-17(20-15)12-8-13(18)10-14(19)9-12/h5-10H,2-4H2,1H3 |
| InChIKey | CZIUIIMRTHSGJY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole?
The IUPAC name of 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole (CID 163207320) is 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole.
What is the SMILES notation for 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole?
The canonical SMILES for 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole is CCCCc1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1.
What is the InChIKey of 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole?
The InChIKey is CZIUIIMRTHSGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2NO/c1-2-3-4-11-5-6-15-16(7-11)21-17(20-15)12-8-13(18)10-14(19)9-12/h5-10H,2-4H2,1H3.
What are the key properties of 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole?
6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole has a molecular weight of 320.22 g/mol, XLogP of 6.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole is sourced from PubChem (CID 163207320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).