C17H15Cl2NO — CID 163207320
6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole (PubChem CID 163207320) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole.
| Compound Name | 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 163207320 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6-butyl-2-(3,5-dichlorophenyl)-1,3-benzoxazole |
| SMILES | CCCCc1ccc2nc(-c3cc(Cl)cc(Cl)c3)oc2c1 |
| InChI | InChI=1S/C17H15Cl2NO/c1-2-3-4-11-5-6-15-16(7-11)21-17(20-15)12-8-13(18)10-14(19)9-12/h5-10H,2-4H2,1H3 |
| InChIKey | CZIUIIMRTHSGJY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |