C26H25F3N2O3 — CID 87416150
3-[[4-[2-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid (PubChem CID 87416150) has the molecular formula C26H25F3N2O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is 3-[[4-[2-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[2-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 87416150 |
| Molecular Formula | C26H25F3N2O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 3-[[4-[2-[[4-phenyl-2-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc(CC=NOCc2ccc(-c3ccccc3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H25F3N2O3/c27-26(28,29)24-16-22(21-4-2-1-3-5-21)10-11-23(24)18-34-31-15-12-19-6-8-20(9-7-19)17-30-14-13-25(32)33/h1-11,15-16,30H,12-14,17-18H2,(H,32,33) |
| InChIKey | YRNOVPDGZLMVPI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|