C25H25FN2O3 — CID 87416097
3-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid (PubChem CID 87416097) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is 3-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 87416097 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc(CC=NOCc2ccc(-c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H25FN2O3/c26-24-11-9-23(10-12-24)22-7-5-21(6-8-22)18-31-28-16-13-19-1-3-20(4-2-19)17-27-15-14-25(29)30/h1-12,16,27H,13-15,17-18H2,(H,29,30) |
| InChIKey | HAJDMALEPFYFHN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|