C26H25F3N2O4 — CID 87416198
2-hydroxy-3-[[4-[2-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid (PubChem CID 87416198) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is 2-hydroxy-3-[[4-[2-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid.
| Compound Name | 2-hydroxy-3-[[4-[2-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 87416198 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-hydroxy-3-[[4-[2-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyimino]ethyl]phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)C(O)CNCc1ccc(CC=NOCc2ccc(-c3ccccc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H25F3N2O4/c27-26(28,29)23-14-20(10-11-22(23)21-4-2-1-3-5-21)17-35-31-13-12-18-6-8-19(9-7-18)15-30-16-24(32)25(33)34/h1-11,13-14,24,30,32H,12,15-17H2,(H,33,34) |
| InChIKey | HFVGHORFUYTMFP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|