C15H10F5NO2 — CID 177409244
4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]ethyl]phenol (PubChem CID 177409244) has the molecular formula C15H10F5NO2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]ethyl]phenol.
| Compound Name | 4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]ethyl]phenol |
|---|---|
| PubChem CID | 177409244 |
| Molecular Formula | C15H10F5NO2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-[(2E)-2-[(2,3,4,5,6-pentafluorophenyl)methoxyimino]ethyl]phenol |
| SMILES | Oc1ccc(C/C=N/OCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H10F5NO2/c16-11-10(12(17)14(19)15(20)13(11)18)7-23-21-6-5-8-1-3-9(22)4-2-8/h1-4,6,22H,5,7H2/b21-6+ |
| InChIKey | NZKJIBFIOUMXBE-AERZKKPOSA-N |
| XLogP | 3.83 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|