C12H6F5NO2 — CID 171139142
1-(furan-2-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine (PubChem CID 171139142) has the molecular formula C12H6F5NO2 and a molecular weight of 291.17 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine.
| Compound Name | 1-(furan-2-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine |
|---|---|
| PubChem CID | 171139142 |
| Molecular Formula | C12H6F5NO2 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1-(furan-2-yl)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine |
| SMILES | Fc1c(F)c(F)c(CON=Cc2ccco2)c(F)c1F |
| InChI | InChI=1S/C12H6F5NO2/c13-8-7(9(14)11(16)12(17)10(8)15)5-20-18-4-6-2-1-3-19-6/h1-4H,5H2 |
| InChIKey | PLTMCEIKUMIAJJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|