C14H8F5NO2 — CID 136663914
2-[(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenol (PubChem CID 136663914) has the molecular formula C14H8F5NO2 and a molecular weight of 317.21 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenol.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenol |
|---|---|
| PubChem CID | 136663914 |
| Molecular Formula | C14H8F5NO2 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenol |
| SMILES | Oc1ccccc1C=NOCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H8F5NO2/c15-10-8(11(16)13(18)14(19)12(10)17)6-22-20-5-7-3-1-2-4-9(7)21/h1-5,21H,6H2 |
| InChIKey | BWNAPEPFRCHYRY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|