C21H10F5N3O3 — CID 137331352
6-[(E)-(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenazine-1-carboxylic acid (PubChem CID 137331352) has the molecular formula C21H10F5N3O3 and a molecular weight of 447.32 g/mol. Its IUPAC name is 6-[(E)-(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenazine-1-carboxylic acid.
| Compound Name | 6-[(E)-(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenazine-1-carboxylic acid |
|---|---|
| PubChem CID | 137331352 |
| Molecular Formula | C21H10F5N3O3 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 6-[(E)-(2,3,4,5,6-pentafluorophenyl)methoxyiminomethyl]phenazine-1-carboxylic acid |
| SMILES | O=C(O)c1cccc2nc3c(/C=N/OCc4c(F)c(F)c(F)c(F)c4F)cccc3nc12 |
| InChI | InChI=1S/C21H10F5N3O3/c22-14-11(15(23)17(25)18(26)16(14)24)8-32-27-7-9-3-1-5-12-19(9)28-13-6-2-4-10(21(30)31)20(13)29-12/h1-7H,8H2,(H,30,31)/b27-7+ |
| InChIKey | BGESJKJVJSPCAU-OAHLVZFQSA-N |
| XLogP | 4.73 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|