C26H26N4O8 — CID 139118549
3,6-bis[(E)-2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2-diol (PubChem CID 139118549) has the molecular formula C26H26N4O8 and a molecular weight of 522.51 g/mol. Its IUPAC name is 3,6-bis[(E)-2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2-diol.
| Compound Name | 3,6-bis[(E)-2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 139118549 |
| Molecular Formula | C26H26N4O8 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 3,6-bis[(E)-2-[(E)-(2-hydroxyphenyl)methylideneamino]oxyethoxyiminomethyl]benzene-1,2-diol |
| SMILES | Oc1ccccc1/C=N/OCCO/N=C/c1ccc(/C=N/OCCO/N=C/c2ccccc2O)c(O)c1O |
| InChI | InChI=1S/C26H26N4O8/c31-23-7-3-1-5-19(23)15-27-35-11-13-37-29-17-21-9-10-22(26(34)25(21)33)18-30-38-14-12-36-28-16-20-6-2-4-8-24(20)32/h1-10,15-18,31-34H,11-14H2/b27-15+,28-16+,29-17+,30-18+ |
| InChIKey | BTWACNOBKJEJSO-JMIZQSJKSA-N |
| XLogP | 3.31 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|