C9H8NNaO3 — CID 135760717
sodium 2-[(2-hydroxyphenyl)methylideneamino]acetate (PubChem CID 135760717) has the molecular formula C9H8NNaO3 and a molecular weight of 201.16 g/mol. Its IUPAC name is sodium 2-[(2-hydroxyphenyl)methylideneamino]acetate.
| Compound Name | sodium 2-[(2-hydroxyphenyl)methylideneamino]acetate |
|---|---|
| PubChem CID | 135760717 |
| Molecular Formula | C9H8NNaO3 |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | sodium 2-[(2-hydroxyphenyl)methylideneamino]acetate |
| SMILES | O=C([O-])C/N=C/c1ccccc1O.[Na+] |
| InChI | InChI=1S/C9H9NO3.Na/c11-8-4-2-1-3-7(8)5-10-6-9(12)13;/h1-5,11H,6H2,(H,12,13);/q;+1/p-1/b10-5+; |
| InChIKey | IUXRXTKLNRJJEZ-OAZHBLANSA-M |
| XLogP | -3.43 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|