C21H30N4O5 — CID 163640259
2-amino-N,N-dimethylacetamide;benzene-1,2-diol;2-[(2-hydroxyphenyl)methylideneamino]-N,N-dimethylacetamide (PubChem CID 163640259) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-amino-N,N-dimethylacetamide;benzene-1,2-diol;2-[(2-hydroxyphenyl)methylideneamino]-N,N-dimethylacetamide.
| Compound Name | 2-amino-N,N-dimethylacetamide;benzene-1,2-diol;2-[(2-hydroxyphenyl)methylideneamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 163640259 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-amino-N,N-dimethylacetamide;benzene-1,2-diol;2-[(2-hydroxyphenyl)methylideneamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C/c1ccccc1O.CN(C)C(=O)CN.Oc1ccccc1O |
| InChI | InChI=1S/C11H14N2O2.C6H6O2.C4H10N2O/c1-13(2)11(15)8-12-7-9-5-3-4-6-10(9)14;7-5-3-1-2-4-6(5)8;1-6(2)4(7)3-5/h3-7,14H,8H2,1-2H3;1-4,7-8H;3,5H2,1-2H3/b12-7+;; |
| InChIKey | IDQFTAKEBNUJMT-CURPJKDSSA-N |
| XLogP | 1.03 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|