C18H10F10N2O2 — CID 5374811
2-N,3-N-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]butane-2,3-diimine (PubChem CID 5374811) has the molecular formula C18H10F10N2O2 and a molecular weight of 476.27 g/mol. Its IUPAC name is 2-N,3-N-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]butane-2,3-diimine |
|---|---|
| PubChem CID | 5374811 |
| Molecular Formula | C18H10F10N2O2 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-N,3-N-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]butane-2,3-diimine |
| SMILES | CC(=N/OCc1c(F)c(F)c(F)c(F)c1F)/C(C)=N/OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H10F10N2O2/c1-5(29-31-3-7-9(19)13(23)17(27)14(24)10(7)20)6(2)30-32-4-8-11(21)15(25)18(28)16(26)12(8)22/h3-4H2,1-2H3/b29-5-,30-6+ |
| InChIKey | FJVTVBQIHZZDBE-VONOUILESA-N |
| XLogP | 5.56 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|