C17H16Br2F5NO — CID 172965575
(E,2E,4R,6S)-4,6-dibromo-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,7-dien-1-imine (PubChem CID 172965575) has the molecular formula C17H16Br2F5NO and a molecular weight of 505.12 g/mol. Its IUPAC name is (E,2E,4R,6S)-4,6-dibromo-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,7-dien-1-imine.
| Compound Name | (E,2E,4R,6S)-4,6-dibromo-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,7-dien-1-imine |
|---|---|
| PubChem CID | 172965575 |
| Molecular Formula | C17H16Br2F5NO |
| Molecular Weight | 505.12 g/mol |
| Exact Mass | 502.95 |
| IUPAC Name | (E,2E,4R,6S)-4,6-dibromo-3,7-dimethyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]octa-2,7-dien-1-imine |
| SMILES | C=C(C)[C@@H](Br)C[C@@H](Br)/C(C)=C/C=N/OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H16Br2F5NO/c1-8(2)11(18)6-12(19)9(3)4-5-25-26-7-10-13(20)15(22)17(24)16(23)14(10)21/h4-5,11-12H,1,6-7H2,2-3H3/b9-4+,25-5+/t11-,12+/m0/s1 |
| InChIKey | AABFPTARQKBOHY-BUQQZFMYSA-N |
| XLogP | 6.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.12 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|