C27H24F10N2O4 — CID 91752405
methyl (Z,9E,12Z)-9,12-bis[(2,3,4,5,6-pentafluorophenyl)methoxyimino]dodec-10-enoate (PubChem CID 91752405) has the molecular formula C27H24F10N2O4 and a molecular weight of 630.48 g/mol. Its IUPAC name is methyl (Z,9E,12Z)-9,12-bis[(2,3,4,5,6-pentafluorophenyl)methoxyimino]dodec-10-enoate.
| Compound Name | methyl (Z,9E,12Z)-9,12-bis[(2,3,4,5,6-pentafluorophenyl)methoxyimino]dodec-10-enoate |
|---|---|
| PubChem CID | 91752405 |
| Molecular Formula | C27H24F10N2O4 |
| Molecular Weight | 630.48 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | methyl (Z,9E,12Z)-9,12-bis[(2,3,4,5,6-pentafluorophenyl)methoxyimino]dodec-10-enoate |
| SMILES | COC(=O)CCCCCCCC(/C=C\C=N/OCc1c(F)c(F)c(F)c(F)c1F)=N\OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H24F10N2O4/c1-41-17(40)10-6-4-2-3-5-8-14(39-43-13-16-20(30)24(34)27(37)25(35)21(16)31)9-7-11-38-42-12-15-18(28)22(32)26(36)23(33)19(15)29/h7,9,11H,2-6,8,10,12-13H2,1H3/b9-7-,38-11-,39-14+ |
| InChIKey | ZGSYEMOJGIYNMK-QUAZDCGGSA-N |
| XLogP | 7.61 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.48 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|