C15H18F5NO — CID 91752800
(E)-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]heptan-3-imine (PubChem CID 91752800) has the molecular formula C15H18F5NO and a molecular weight of 323.31 g/mol. Its IUPAC name is (E)-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]heptan-3-imine.
| Compound Name | (E)-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]heptan-3-imine |
|---|---|
| PubChem CID | 91752800 |
| Molecular Formula | C15H18F5NO |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (E)-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]heptan-3-imine |
| SMILES | CCCC/C(=N\OCc1c(F)c(F)c(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C15H18F5NO/c1-4-5-6-10(8(2)3)21-22-7-9-11(16)13(18)15(20)14(19)12(9)17/h8H,4-7H2,1-3H3/b21-10+ |
| InChIKey | MVHPLUGMPFYDEJ-UFFVCSGVSA-N |
| XLogP | 5.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|