C15H10NO2S- — CID 5092860
2-(2-phenyl-1,3-benzothiazol-5-yl)acetate (PubChem CID 5092860) has the molecular formula C15H10NO2S- and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-(2-phenyl-1,3-benzothiazol-5-yl)acetate.
| Compound Name | 2-(2-phenyl-1,3-benzothiazol-5-yl)acetate |
|---|---|
| PubChem CID | 5092860 |
| Molecular Formula | C15H10NO2S- |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2-(2-phenyl-1,3-benzothiazol-5-yl)acetate |
| SMILES | O=C([O-])Cc1ccc2sc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C15H11NO2S/c17-14(18)9-10-6-7-13-12(8-10)16-15(19-13)11-4-2-1-3-5-11/h1-8H,9H2,(H,17,18)/p-1 |
| InChIKey | CGJFGPQHBSLGOO-UHFFFAOYSA-M |
| XLogP | 2.26 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |