About benzoic acid;phenylmethanol
benzoic acid;phenylmethanol (PubChem CID 175191007) has the molecular formula C21H20O5
and a molecular weight of 352.39 g/mol. Its IUPAC name is benzoic acid;phenylmethanol.
Molecular Properties
| Compound Name | benzoic acid;phenylmethanol |
| PubChem CID | 175191007 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | benzoic acid;phenylmethanol |
| SMILES | O=C(O)c1ccccc1.O=C(O)c1ccccc1.OCc1ccccc1 |
| InChI | InChI=1S/2C7H6O2.C7H8O/c2*8-7(9)6-4-2-1-3-5-6;8-6-7-4-2-1-3-5-7/h2*1-5H,(H,8,9);1-5,8H,6H2 |
| InChIKey | DJXQAHWNERPZEN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;phenylmethanol?
The IUPAC name of benzoic acid;phenylmethanol (CID 175191007) is benzoic acid;phenylmethanol.
What is the SMILES notation for benzoic acid;phenylmethanol?
The canonical SMILES for benzoic acid;phenylmethanol is O=C(O)c1ccccc1.O=C(O)c1ccccc1.OCc1ccccc1.
What is the InChIKey of benzoic acid;phenylmethanol?
The InChIKey is DJXQAHWNERPZEN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6O2.C7H8O/c2*8-7(9)6-4-2-1-3-5-6;8-6-7-4-2-1-3-5-7/h2*1-5H,(H,8,9);1-5,8H,6H2.
What are the key properties of benzoic acid;phenylmethanol?
benzoic acid;phenylmethanol has a molecular weight of 352.39 g/mol, XLogP of 3.95, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;phenylmethanol is sourced from PubChem (CID 175191007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).