About phenylmethanol;tetrabromomethane
phenylmethanol;tetrabromomethane (PubChem CID 174808232) has the molecular formula C8H8Br4O
and a molecular weight of 439.77 g/mol. Its IUPAC name is phenylmethanol;tetrabromomethane.
Molecular Properties
| Compound Name | phenylmethanol;tetrabromomethane |
| PubChem CID | 174808232 |
| Molecular Formula | C8H8Br4O |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 435.73 |
| IUPAC Name | phenylmethanol;tetrabromomethane |
| SMILES | BrC(Br)(Br)Br.OCc1ccccc1 |
| InChI | InChI=1S/C7H8O.CBr4/c8-6-7-4-2-1-3-5-7;2-1(3,4)5/h1-5,8H,6H2; |
| InChIKey | IYMIMXVWCPLCDC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanol;tetrabromomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanol;tetrabromomethane?
The IUPAC name of phenylmethanol;tetrabromomethane (CID 174808232) is phenylmethanol;tetrabromomethane.
What is the SMILES notation for phenylmethanol;tetrabromomethane?
The canonical SMILES for phenylmethanol;tetrabromomethane is BrC(Br)(Br)Br.OCc1ccccc1.
What is the InChIKey of phenylmethanol;tetrabromomethane?
The InChIKey is IYMIMXVWCPLCDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.CBr4/c8-6-7-4-2-1-3-5-7;2-1(3,4)5/h1-5,8H,6H2;.
What are the key properties of phenylmethanol;tetrabromomethane?
phenylmethanol;tetrabromomethane has a molecular weight of 439.77 g/mol, XLogP of 4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanol;tetrabromomethane is sourced from PubChem (CID 174808232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).