About phenylmethanol;tetrachloromethane
phenylmethanol;tetrachloromethane (PubChem CID 174952839) has the molecular formula C8H8Cl4O
and a molecular weight of 261.96 g/mol. Its IUPAC name is phenylmethanol;tetrachloromethane.
Molecular Properties
| Compound Name | phenylmethanol;tetrachloromethane |
| PubChem CID | 174952839 |
| Molecular Formula | C8H8Cl4O |
| Molecular Weight | 261.96 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | phenylmethanol;tetrachloromethane |
| SMILES | ClC(Cl)(Cl)Cl.OCc1ccccc1 |
| InChI | InChI=1S/C7H8O.CCl4/c8-6-7-4-2-1-3-5-7;2-1(3,4)5/h1-5,8H,6H2; |
| InChIKey | FFRJXBQBCOJYFO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.96 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanol;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanol;tetrachloromethane?
The IUPAC name of phenylmethanol;tetrachloromethane (CID 174952839) is phenylmethanol;tetrachloromethane.
What is the SMILES notation for phenylmethanol;tetrachloromethane?
The canonical SMILES for phenylmethanol;tetrachloromethane is ClC(Cl)(Cl)Cl.OCc1ccccc1.
What is the InChIKey of phenylmethanol;tetrachloromethane?
The InChIKey is FFRJXBQBCOJYFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.CCl4/c8-6-7-4-2-1-3-5-7;2-1(3,4)5/h1-5,8H,6H2;.
What are the key properties of phenylmethanol;tetrachloromethane?
phenylmethanol;tetrachloromethane has a molecular weight of 261.96 g/mol, XLogP of 3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanol;tetrachloromethane is sourced from PubChem (CID 174952839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).