C18H17N3O2 — CID 10018090
3-(piperidin-1-ylmethyl)pyrido[3,2-g]quinoline-5,10-dione (PubChem CID 10018090) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-(piperidin-1-ylmethyl)pyrido[3,2-g]quinoline-5,10-dione.
| Compound Name | 3-(piperidin-1-ylmethyl)pyrido[3,2-g]quinoline-5,10-dione |
|---|---|
| PubChem CID | 10018090 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-(piperidin-1-ylmethyl)pyrido[3,2-g]quinoline-5,10-dione |
| SMILES | O=C1c2cccnc2C(=O)c2ncc(CN3CCCCC3)cc21 |
| InChI | InChI=1S/C18H17N3O2/c22-17-13-5-4-6-19-15(13)18(23)16-14(17)9-12(10-20-16)11-21-7-2-1-3-8-21/h4-6,9-10H,1-3,7-8,11H2 |
| InChIKey | HQKRMDLQCGBUJG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|