C20H22N2O2 — CID 12020016
3,7-dibutylpyrido[3,2-g]quinoline-5,10-dione (PubChem CID 12020016) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3,7-dibutylpyrido[3,2-g]quinoline-5,10-dione.
| Compound Name | 3,7-dibutylpyrido[3,2-g]quinoline-5,10-dione |
|---|---|
| PubChem CID | 12020016 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3,7-dibutylpyrido[3,2-g]quinoline-5,10-dione |
| SMILES | CCCCc1cnc2c(c1)C(=O)c1cc(CCCC)cnc1C2=O |
| InChI | InChI=1S/C20H22N2O2/c1-3-5-7-13-9-15-17(21-11-13)20(24)18-16(19(15)23)10-14(12-22-18)8-6-4-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | HWFYPDKIGRWYRO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|