C18H17N3O4 — CID 11809932
(5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-tert-butylcarbamate (PubChem CID 11809932) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-tert-butylcarbamate.
| Compound Name | (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 11809932 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (5,10-dioxopyrido[3,2-g]quinolin-3-yl)methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCc1cnc2c(c1)C(=O)c1cccnc1C2=O |
| InChI | InChI=1S/C18H17N3O4/c1-18(2,3)21-17(24)25-9-10-7-12-14(20-8-10)16(23)13-11(15(12)22)5-4-6-19-13/h4-8H,9H2,1-3H3,(H,21,24) |
| InChIKey | PBYGPKMYTYZQFE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|