C19H19N3O4 — CID 10937100
tert-butyl N-[2-(5,10-dioxopyrido[3,2-g]quinolin-6-yl)ethyl]carbamate (PubChem CID 10937100) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is tert-butyl N-[2-(5,10-dioxopyrido[3,2-g]quinolin-6-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5,10-dioxopyrido[3,2-g]quinolin-6-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 10937100 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | tert-butyl N-[2-(5,10-dioxopyrido[3,2-g]quinolin-6-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccnc2c1C(=O)c1cccnc1C2=O |
| InChI | InChI=1S/C19H19N3O4/c1-19(2,3)26-18(25)22-10-7-11-6-9-21-15-13(11)16(23)12-5-4-8-20-14(12)17(15)24/h4-6,8-9H,7,10H2,1-3H3,(H,22,25) |
| InChIKey | WTAMCJWNMHRNPX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|