C16H21BN2O4 — CID 150878167
[8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-6-yl]boronic acid (PubChem CID 150878167) has the molecular formula C16H21BN2O4 and a molecular weight of 316.17 g/mol. Its IUPAC name is [8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-6-yl]boronic acid.
| Compound Name | [8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-6-yl]boronic acid |
|---|---|
| PubChem CID | 150878167 |
| Molecular Formula | C16H21BN2O4 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [8-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]quinolin-6-yl]boronic acid |
| SMILES | CC(C)(C)OC(=O)NCCc1cc(B(O)O)cc2cccnc12 |
| InChI | InChI=1S/C16H21BN2O4/c1-16(2,3)23-15(20)19-8-6-12-10-13(17(21)22)9-11-5-4-7-18-14(11)12/h4-5,7,9-10,21-22H,6,8H2,1-3H3,(H,19,20) |
| InChIKey | KVLFIYGMPAOAFV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|