C23H14O8 — CID 118584439
[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxymethyl benzoate (PubChem CID 118584439) has the molecular formula C23H14O8 and a molecular weight of 418.36 g/mol. Its IUPAC name is [3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxymethyl benzoate.
| Compound Name | [3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxymethyl benzoate |
|---|---|
| PubChem CID | 118584439 |
| Molecular Formula | C23H14O8 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxymethyl benzoate |
| SMILES | O=C(CC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O)OCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H14O8/c24-17(11-19(25)29-12-30-23(28)13-6-2-1-3-7-13)18-10-16-20(26)14-8-4-5-9-15(14)21(27)22(16)31-18/h1-10H,11-12H2 |
| InChIKey | DBPPWFHNAOXXNG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|