C19H16O6 — CID 118584436
2-methylpropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate (PubChem CID 118584436) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-methylpropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate.
| Compound Name | 2-methylpropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 118584436 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-methylpropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate |
| SMILES | CC(C)COC(=O)/C=C(\O)c1cc2c(o1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H16O6/c1-10(2)9-24-16(21)8-14(20)15-7-13-17(22)11-5-3-4-6-12(11)18(23)19(13)25-15/h3-8,10,20H,9H2,1-2H3/b14-8- |
| InChIKey | JTHAFIUTXPEFTD-ZSOIEALJSA-N |
| XLogP | 3.15 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|