C24H18O7 — CID 118584401
2-phenylmethoxyethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate (PubChem CID 118584401) has the molecular formula C24H18O7 and a molecular weight of 418.40 g/mol. Its IUPAC name is 2-phenylmethoxyethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate.
| Compound Name | 2-phenylmethoxyethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 118584401 |
| Molecular Formula | C24H18O7 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-phenylmethoxyethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate |
| SMILES | O=C(CC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O)OCCOCc1ccccc1 |
| InChI | InChI=1S/C24H18O7/c25-19(13-21(26)30-11-10-29-14-15-6-2-1-3-7-15)20-12-18-22(27)16-8-4-5-9-17(16)23(28)24(18)31-20/h1-9,12H,10-11,13-14H2 |
| InChIKey | QLOLNDANLKPBQV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|