C17H12N4O6 — CID 129022556
2,3-dihydro-1H-tetrazol-5-ylmethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate (PubChem CID 129022556) has the molecular formula C17H12N4O6 and a molecular weight of 368.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-tetrazol-5-ylmethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate.
| Compound Name | 2,3-dihydro-1H-tetrazol-5-ylmethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 129022556 |
| Molecular Formula | C17H12N4O6 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2,3-dihydro-1H-tetrazol-5-ylmethyl 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoate |
| SMILES | O=C(CC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O)OCC1=NNNN1 |
| InChI | InChI=1S/C17H12N4O6/c22-11(6-14(23)26-7-13-18-20-21-19-13)12-5-10-15(24)8-3-1-2-4-9(8)16(25)17(10)27-12/h1-5,20-21H,6-7H2,(H,18,19) |
| InChIKey | OCGSOBQNYJQZHE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|