C21H18O8 — CID 129088954
6-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyhexanoic acid (PubChem CID 129088954) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is 6-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyhexanoic acid.
| Compound Name | 6-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyhexanoic acid |
|---|---|
| PubChem CID | 129088954 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 6-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOC(=O)CC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H18O8/c22-15(11-18(25)28-9-5-1-2-8-17(23)24)16-10-14-19(26)12-6-3-4-7-13(12)20(27)21(14)29-16/h3-4,6-7,10H,1-2,5,8-9,11H2,(H,23,24) |
| InChIKey | XOXJLEYAWNHBAU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|