C22H18O10 — CID 139393968
5-[2-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyethoxy]-5-oxopentanoic acid (PubChem CID 139393968) has the molecular formula C22H18O10 and a molecular weight of 442.38 g/mol. Its IUPAC name is 5-[2-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyethoxy]-5-oxopentanoic acid.
| Compound Name | 5-[2-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyethoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139393968 |
| Molecular Formula | C22H18O10 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 5-[2-[3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanoyl]oxyethoxy]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)OCCOC(=O)CC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H18O10/c23-15(11-19(27)31-9-8-30-18(26)7-3-6-17(24)25)16-10-14-20(28)12-4-1-2-5-13(12)21(29)22(14)32-16/h1-2,4-5,10H,3,6-9,11H2,(H,24,25) |
| InChIKey | IOFSMELVXOJDKU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|