C18H13KO8 — CID 140912479
potassium (Z)-3-(2,3-dihydroxypropoxy)-1-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxoprop-1-en-1-olate (PubChem CID 140912479) has the molecular formula C18H13KO8 and a molecular weight of 396.39 g/mol. Its IUPAC name is potassium (Z)-3-(2,3-dihydroxypropoxy)-1-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxoprop-1-en-1-olate.
| Compound Name | potassium (Z)-3-(2,3-dihydroxypropoxy)-1-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 140912479 |
| Molecular Formula | C18H13KO8 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | potassium (Z)-3-(2,3-dihydroxypropoxy)-1-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxoprop-1-en-1-olate |
| SMILES | O=C(/C=C(\[O-])c1cc2c(o1)C(=O)c1ccccc1C2=O)OCC(O)CO.[K+] |
| InChI | InChI=1S/C18H14O8.K/c19-7-9(20)8-25-15(22)6-13(21)14-5-12-16(23)10-3-1-2-4-11(10)17(24)18(12)26-14;/h1-6,9,19-21H,7-8H2;/q;+1/p-1/b13-6-; |
| InChIKey | YVEZIISAWPQBTD-FJMCHERXSA-M |
| XLogP | -3.34 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|