C22H23NO9 — CID 144975850
3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanal;3-methoxypropyl 2-amino-3-hydroxypropanoate (PubChem CID 144975850) has the molecular formula C22H23NO9 and a molecular weight of 445.42 g/mol. Its IUPAC name is 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanal;3-methoxypropyl 2-amino-3-hydroxypropanoate.
| Compound Name | 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanal;3-methoxypropyl 2-amino-3-hydroxypropanoate |
|---|---|
| PubChem CID | 144975850 |
| Molecular Formula | C22H23NO9 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-oxopropanal;3-methoxypropyl 2-amino-3-hydroxypropanoate |
| SMILES | COCCCOC(=O)C(N)CO.O=CCC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H8O5.C7H15NO4/c16-6-5-11(17)12-7-10-13(18)8-3-1-2-4-9(8)14(19)15(10)20-12;1-11-3-2-4-12-7(10)6(8)5-9/h1-4,6-7H,5H2;6,9H,2-5,8H2,1H3 |
| InChIKey | AANUJZCLJWKHCA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 163.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|