C26H32O13 — CID 158232281
2,3-dihydroxypropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate;(2R,3R,4R,5S)-octane-1,2,3,4,5-pentol (PubChem CID 158232281) has the molecular formula C26H32O13 and a molecular weight of 552.53 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate;(2R,3R,4R,5S)-octane-1,2,3,4,5-pentol.
| Compound Name | 2,3-dihydroxypropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate;(2R,3R,4R,5S)-octane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 158232281 |
| Molecular Formula | C26H32O13 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2,3-dihydroxypropyl (Z)-3-(4,9-dioxobenzo[f][1]benzofuran-2-yl)-3-hydroxyprop-2-enoate;(2R,3R,4R,5S)-octane-1,2,3,4,5-pentol |
| SMILES | CCC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(/C=C(\O)c1cc2c(o1)C(=O)c1ccccc1C2=O)OCC(O)CO |
| InChI | InChI=1S/C18H14O8.C8H18O5/c19-7-9(20)8-25-15(22)6-13(21)14-5-12-16(23)10-3-1-2-4-11(10)17(24)18(12)26-14;1-2-3-5(10)7(12)8(13)6(11)4-9/h1-6,9,19-21H,7-8H2;5-13H,2-4H2,1H3/b13-6-;/t;5-,6+,7+,8+/m.0/s1 |
| InChIKey | GENGRZSLQDVBBL-MUPMXZJOSA-N |
| XLogP | -0.93 |
| TPSA | 235.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|