C23H13NO2 — CID 154370739
2-benzoylphenaleno[2,3-b]pyridin-7-one (PubChem CID 154370739) has the molecular formula C23H13NO2 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-benzoylphenaleno[2,3-b]pyridin-7-one.
| Compound Name | 2-benzoylphenaleno[2,3-b]pyridin-7-one |
|---|---|
| PubChem CID | 154370739 |
| Molecular Formula | C23H13NO2 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-benzoylphenaleno[2,3-b]pyridin-7-one |
| SMILES | O=C(c1ccccc1)c1cc2c3c(cccc3c1)C(=O)c1ncccc1-2 |
| InChI | InChI=1S/C23H13NO2/c25-22(14-6-2-1-3-7-14)16-12-15-8-4-9-18-20(15)19(13-16)17-10-5-11-24-21(17)23(18)26/h1-13H |
| InChIKey | RIQRFHFSGQXFHP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |