C16H7Br2NO — CID 151541746
1,2-dibromophenaleno[2,3-b]pyridin-7-one (PubChem CID 151541746) has the molecular formula C16H7Br2NO and a molecular weight of 389.05 g/mol. Its IUPAC name is 1,2-dibromophenaleno[2,3-b]pyridin-7-one.
| Compound Name | 1,2-dibromophenaleno[2,3-b]pyridin-7-one |
|---|---|
| PubChem CID | 151541746 |
| Molecular Formula | C16H7Br2NO |
| Molecular Weight | 389.05 g/mol |
| Exact Mass | 386.89 |
| IUPAC Name | 1,2-dibromophenaleno[2,3-b]pyridin-7-one |
| SMILES | O=C1c2ncccc2-c2c(Br)c(Br)cc3cccc1c23 |
| InChI | InChI=1S/C16H7Br2NO/c17-11-7-8-3-1-4-10-12(8)13(14(11)18)9-5-2-6-19-15(9)16(10)20/h1-7H |
| InChIKey | PYPQXSQFRUDYKE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.05 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |