C17H8Cl2O — CID 20841807
1,2-dichlorobenzo[b]phenalen-7-one (PubChem CID 20841807) has the molecular formula C17H8Cl2O and a molecular weight of 299.16 g/mol. Its IUPAC name is 1,2-dichlorobenzo[b]phenalen-7-one.
| Compound Name | 1,2-dichlorobenzo[b]phenalen-7-one |
|---|---|
| PubChem CID | 20841807 |
| Molecular Formula | C17H8Cl2O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 1,2-dichlorobenzo[b]phenalen-7-one |
| SMILES | O=C1c2ccccc2-c2c(Cl)c(Cl)cc3cccc1c23 |
| InChI | InChI=1S/C17H8Cl2O/c18-13-8-9-4-3-7-12-14(9)15(16(13)19)10-5-1-2-6-11(10)17(12)20/h1-8H |
| InChIKey | BTRQGGVLDWMVPD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |