C18H7N3O — CID 71724701
1-oxophenaleno[4,5-b]pyridine-2,3-dicarbonitrile (PubChem CID 71724701) has the molecular formula C18H7N3O and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-oxophenaleno[4,5-b]pyridine-2,3-dicarbonitrile.
| Compound Name | 1-oxophenaleno[4,5-b]pyridine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 71724701 |
| Molecular Formula | C18H7N3O |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 1-oxophenaleno[4,5-b]pyridine-2,3-dicarbonitrile |
| SMILES | N#CC1=C(C#N)c2cccc3cc4cccnc4c(c23)C1=O |
| InChI | InChI=1S/C18H7N3O/c19-8-13-12-5-1-3-10-7-11-4-2-6-21-17(11)16(15(10)12)18(22)14(13)9-20/h1-7H |
| InChIKey | XBAPQWIXSVSLOK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|