C12H5NO4 — CID 142308030
4,9-dioxofuro[3,2-g]quinoline-2-carbaldehyde (PubChem CID 142308030) has the molecular formula C12H5NO4 and a molecular weight of 227.18 g/mol. Its IUPAC name is 4,9-dioxofuro[3,2-g]quinoline-2-carbaldehyde.
| Compound Name | 4,9-dioxofuro[3,2-g]quinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 142308030 |
| Molecular Formula | C12H5NO4 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 4,9-dioxofuro[3,2-g]quinoline-2-carbaldehyde |
| SMILES | O=Cc1cc2c(o1)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C12H5NO4/c14-5-6-4-8-10(15)7-2-1-3-13-9(7)11(16)12(8)17-6/h1-5H |
| InChIKey | YXAHXBUQSGESGE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|