C24H16N2O — CID 160581991
5H-indeno[1,2-b]pyridine;indeno[1,2-b]pyridin-5-one (PubChem CID 160581991) has the molecular formula C24H16N2O and a molecular weight of 348.41 g/mol. Its IUPAC name is 5H-indeno[1,2-b]pyridine;indeno[1,2-b]pyridin-5-one.
| Compound Name | 5H-indeno[1,2-b]pyridine;indeno[1,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 160581991 |
| Molecular Formula | C24H16N2O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5H-indeno[1,2-b]pyridine;indeno[1,2-b]pyridin-5-one |
| SMILES | O=C1c2ccccc2-c2ncccc21.c1ccc2c(c1)Cc1cccnc1-2 |
| InChI | InChI=1S/C12H7NO.C12H9N/c14-12-9-5-2-1-4-8(9)11-10(12)6-3-7-13-11;1-2-6-11-9(4-1)8-10-5-3-7-13-12(10)11/h1-7H;1-7H,8H2 |
| InChIKey | RBXCMFHTWCJBTL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|